ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Ethyl-1-butanol |
|
Produkt-Name | 2-Ethyl-1-butanol |
Englischer Name | 2-Ethyl-1-butanol;2-Ethylbutyl alcohol;2-ethylbutan-1-ol |
Molekulare Formel | C6H14O |
Molecular Weight | 102.1748 |
InChl | InChI=1/C6H14O/c1-3-6(4-2)5-7/h6-7H,3-5H2,1-2H3 |
CAS Registry Number | 97-95-0 |
EINECS | 202-621-4 |
Molecular Structure | |
Dichte | 0.814g/cm3 |
Schmelzpunkt | -15℃ |
Siedepunkt | 146.5°C at 760 mmHg |
Brechungsindex | 1.413 |
Flammpunkt | 58.3°C |
Dampfdruck | 1.81mmHg at 25°C |
Gefahrensymbole | Xn##Harmful:; |
Risk Codes | R21/22##Harmful in contact with skin and if swallowed.:; |
MSDS |