ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Diethyl benzamidomalonate |
|
Produkt-Name | Diethyl benzamidomalonate |
Englischer Name | Diethyl benzamidomalonate;Benzamidomalonic acid diethyl ester;diethyl (benzoylamino)propanedioate;diethyl (phenylcarbamoyl)propanedioate |
Molekulare Formel | C14H17NO5 |
Molecular Weight | 279.2885 |
InChl | InChI=1/C14H17NO5/c1-3-19-13(17)11(14(18)20-4-2)12(16)15-10-8-6-5-7-9-10/h5-9,11H,3-4H2,1-2H3,(H,15,16) |
CAS Registry Number | 96-86-6;16798-45-1 |
EINECS | 202-540-4 |
Molecular Structure | |
Dichte | 1.22g/cm3 |
Siedepunkt | 445.8°C at 760 mmHg |
Brechungsindex | 1.54 |
Flammpunkt | 223.4°C |
Dampfdruck | 3.82E-08mmHg at 25°C |
Safety Beschreibung | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |