ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2,3-heptanedione |
|
Produkt-Name | 2,3-heptanedione |
Englischer Name | 2,3-heptanedione;2,3-Heptanedione;Acetyl pentanoyl;Acetyl valeryl;FEMA No. 2543;NSC 31668;UNII-DK55DDE86P;Valerylacetyl;heptane-2,3-dione |
Molekulare Formel | C7H12O2 |
Molecular Weight | 128.169 |
InChl | InChI=1/C7H12O2/c1-3-4-5-7(9)6(2)8/h3-5H2,1-2H3 |
CAS Registry Number | 96-04-8 |
EINECS | 202-472-5 |
Molecular Structure | |
Dichte | 0.926g/cm3 |
Siedepunkt | 149.7°C at 760 mmHg |
Brechungsindex | 1.413 |
Flammpunkt | 45°C |
Dampfdruck | 3.98mmHg at 25°C |
Risk Codes | R10##Flammable.:; |
Safety Beschreibung | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |