ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
5-Norbornene-2-methanol |
|
Produkt-Name | 5-Norbornene-2-methanol |
Englischer Name | 5-Norbornene-2-methanol;5-Norbornene-2-methanol,mixture of endo and exo;2-Hydroxymethyl-5-norbornene;5-Norborene-2-methanol;5-norbornene-2-methanol(NMO)mixture of endo and exo;bicyclo[2.2.1]hept-5-en-2-ylmethanol;(1R,2S,4R)-bicyclo[2.2.1]hept-5-en-2-ylmethanol |
Molekulare Formel | C8H12O |
Molecular Weight | 124.1803 |
InChl | InChI=1/C8H12O/c9-5-8-4-6-1-2-7(8)3-6/h1-2,6-9H,3-5H2/t6-,7+,8-/m1/s1 |
CAS Registry Number | 95-12-5 |
EINECS | 202-392-0 |
Molecular Structure | |
Dichte | 1.06g/cm3 |
Siedepunkt | 189.2°C at 760 mmHg |
Brechungsindex | 1.53 |
Flammpunkt | 81.6°C |
Dampfdruck | 0.158mmHg at 25°C |
Gefahrensymbole | Xn##Harmful:; |
Risk Codes | R20/21/22:; |
Safety Beschreibung | S36/37/39||S45:; |
MSDS |