ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Ethyl-1,3-hexanediol, mixture of isomers |
|
Produkt-Name | 2-Ethyl-1,3-hexanediol, mixture of isomers |
Englischer Name | 2-Ethyl-1,3-hexanediol, mixture of isomers;Ethohexadiol;2-Ethylhexane-1,3-diol;octylene glycol;2-ethylhexane-1,1-diol;(2S,3S)-2-ethylhexane-1,3-diol;(2R,3S)-2-ethylhexane-1,3-diol;(2R,3R)-2-ethylhexane-1,3-diol;(2S,3R)-2-ethylhexane-1,3-diol;OG;2-Ethyl-1,3-Hexanediol |
Molekulare Formel | C8H18O2 |
Molecular Weight | 146.2273 |
InChl | InChI=1/C8H18O2/c1-3-5-8(10)7(4-2)6-9/h7-10H,3-6H2,1-2H3/t7-,8+/m0/s1 |
CAS Registry Number | 94-96-2 |
EINECS | 202-377-9 |
Molecular Structure | |
Dichte | 0.935g/cm3 |
Schmelzpunkt | -40℃ |
Siedepunkt | 243°C at 760 mmHg |
Brechungsindex | 1.45 |
Flammpunkt | 129.4°C |
Wasserlöslichkeit | 42 g/L (20℃) |
Dampfdruck | 0.00558mmHg at 25°C |
Gefahrensymbole | Xi##Irritant:; |
Risk Codes | R41:; |
Safety Beschreibung | S25||S26||S39||S46:; |
MSDS |