ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
94-81-5 MCPB |
|
Produkt-Name | MCPB |
Englischer Name | MCPB;4-(4-Chloro-o-tolyloxy)butyric acid;2,4-MCPB;4-(4-Chloro-2-methylphenoxy)butyric acid;MCPB;4-(2-Methyl-4-chlorophenoxy)butyric acid;2-(4-chloro-2-methylphenoxy)butanoic acid |
Molekulare Formel | C11H13ClO3 |
Molecular Weight | 228.6721 |
InChl | InChI=1/C11H13ClO3/c1-3-9(11(13)14)15-10-5-4-8(12)6-7(10)2/h4-6,9H,3H2,1-2H3,(H,13,14) |
CAS Registry Number | 94-81-5 |
EINECS | 202-365-3 |
Molecular Structure | ![]() |
Dichte | 1.228g/cm3 |
Siedepunkt | 345.1°C at 760 mmHg |
Brechungsindex | 1.536 |
Flammpunkt | 162.5°C |
Dampfdruck | 2.39E-05mmHg at 25°C |
Risk Codes | R22##Harmful if swallowed.:; |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |