ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
94-32-6 ethyl 4-(butylamino)benzoate |
|
Produkt-Name | ethyl 4-(butylamino)benzoate |
Englischer Name | ethyl 4-(butylamino)benzoate;Ethyl 4-(n-butylamino)benzoate;4-(n-Butylamino)benzoic acid ethyl ester;Ethyl-4-n-butylamino-benzoate |
Molekulare Formel | C13H19NO2 |
Molecular Weight | 221.2955 |
InChl | InChI=1/C13H19NO2/c1-3-5-10-14-12-8-6-11(7-9-12)13(15)16-4-2/h6-9,14H,3-5,10H2,1-2H3 |
CAS Registry Number | 94-32-6 |
EINECS | 202-322-9 |
Molecular Structure | |
Dichte | 1.039g/cm3 |
Schmelzpunkt | 68-70℃ |
Siedepunkt | 338.4°C at 760 mmHg |
Brechungsindex | 1.534 |
Flammpunkt | 158.4°C |
Dampfdruck | 9.87E-05mmHg at 25°C |
Safety Beschreibung | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |