ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
5-Nitro-2-benzimidazolinone |
|
Produkt-Name | 5-Nitro-2-benzimidazolinone |
Englischer Name | 5-Nitro-2-benzimidazolinone;2H-Benzimidazol-2-one, 1,3-dihydro-5-nitro-;2-Hydroxy-5-nitrobenzimidazole;5-Nitro-2(3H)-benzimidazolone;5-Nitrobenzimidazol-2-one;NSC 10380;1,3-Dihydro-5-nitro-2H-benzimidazol-2-one;2-Benzimidazolinone, 5-nitro- (8CI);5-nitro-2H-benzimidazol-2-one |
Molekulare Formel | C7H3N3O3 |
Molecular Weight | 177.117 |
InChl | InChI=1/C7H3N3O3/c11-7-8-5-2-1-4(10(12)13)3-6(5)9-7/h1-3H |
CAS Registry Number | 93-84-5 |
EINECS | 202-282-2 |
Molecular Structure | |
Dichte | 1.76g/cm3 |
Siedepunkt | 278°C at 760 mmHg |
Brechungsindex | 1.786 |
Flammpunkt | 121.9°C |
Dampfdruck | 0.00438mmHg at 25°C |
Risk Codes | R20/22##Harmful by inhalation and if swallowed.:; |
Safety Beschreibung | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |