ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
3-Nonanone |
|
Produkt-Name | 3-Nonanone |
Englischer Name | 3-Nonanone;Ethyl n-hexyl ketone;nonan-3-one |
Molekulare Formel | C9H18O |
Molecular Weight | 142.2386 |
InChl | InChI=1/C9H18O/c1-3-5-6-7-8-9(10)4-2/h3-8H2,1-2H3 |
CAS Registry Number | 925-78-0 |
EINECS | 213-125-2 |
Molecular Structure | |
Dichte | 0.816g/cm3 |
Schmelzpunkt | -8℃ |
Siedepunkt | 190.1°C at 760 mmHg |
Brechungsindex | 1.416 |
Flammpunkt | 67.8°C |
Dampfdruck | 0.551mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |