ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
6-Chloro-2-methylquinoline |
|
Produkt-Name | 6-Chloro-2-methylquinoline |
Englischer Name | 6-Chloro-2-methylquinoline;6-Chloroquinaldine;2-Methyl-6-chloroquinoline |
Molekulare Formel | C10H8ClN |
Molecular Weight | 177.6302 |
InChl | InChI=1/C10H8ClN/c1-7-2-3-8-6-9(11)4-5-10(8)12-7/h2-6H,1H3 |
CAS Registry Number | 92-46-6 |
Molecular Structure | |
Dichte | 1.225g/cm3 |
Siedepunkt | 278.2°C at 760 mmHg |
Brechungsindex | 1.634 |
Flammpunkt | 148.7°C |
Dampfdruck | 0.00732mmHg at 25°C |
Safety Beschreibung | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |