ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
9005-84-9 Soluble Starch |
|
Produkt-Name | Soluble Starch |
Englischer Name | Soluble Starch;Starch;starch from maize;starch potato soluble;starch hydrolyzed for electrophoresis*from potato;starch potato hydrolyzed for*electrophoresis;Starch, Soluble, Corn (1.01257);Starch, Soluble GR, Corn (1.01252);Starch, soluble;Starch from potatoes;Starch soluble;Pregelatinized Starch |
Molekulare Formel | C12H22O11 |
Molecular Weight | 342.2948 |
InChl | InChI=1/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5-,6+,7-,8-,9-,10-,11+,12-/m1/s1 |
CAS Registry Number | 9005-84-9 |
EINECS | 232-686-4 |
Molecular Structure | |
Dichte | 1.5 |
Schmelzpunkt | 256-258℃ |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |