ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
89-49-6 Isopulegylacetat, Isomerengemisch |
|
Produkt-Name | Isopulegylacetat, Isomerengemisch |
Synonyme | ;(1R,2R,5R)-5-methyl-2-(1-methylethenyl)cyclohexylacetat; (1R,2R,5S)-5-methyl-2-(1-methylethenyl)cyclohexylacetat; (1R,2S,5S)-5-Methyl-2-(1-methylethenyl)cyclohexylacetat; |
Englischer Name | Isopulegyl acetate, mixture of isomers;(1R,2R,5R)-5-methyl-2-(1-methylethenyl)cyclohexyl acetate;(1R,2R,5S)-5-methyl-2-(1-methylethenyl)cyclohexyl acetate;(1R,2S,5S)-5-methyl-2-(1-methylethenyl)cyclohexyl acetate |
Molekulare Formel | C12H20O2 |
Molecular Weight | 196.286 |
InChl | InChI=1/C12H20O2/c1-8(2)11-6-5-9(3)7-12(11)14-10(4)13/h9,11-12H,1,5-7H2,2-4H3/t9-,11-,12+/m0/s1 |
CAS Registry Number | 89-49-6 |
Molecular Structure | |
Dichte | 0.94g/cm3 |
Siedepunkt | 248°C at 760 mmHg |
Brechungsindex | 1.458 |
Flammpunkt | 85.6°C |
Dampfdruck | 0.0248mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |