ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
88-97-1 phthalamic acid |
|
Produkt-Name | phthalamic acid |
Englischer Name | phthalamic acid;Phthalamic acid, (2-Carboxybenzamide);2-Carboxybenzamide;2-carbamoylbenzoic acid |
Molekulare Formel | C8H7NO3 |
Molecular Weight | 165.1461 |
InChl | InChI=1/C8H7NO3/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H2,9,10)(H,11,12) |
CAS Registry Number | 88-97-1 |
EINECS | 201-871-1 |
Molecular Structure | |
Dichte | 1.368g/cm3 |
Siedepunkt | 394.2°C at 760 mmHg |
Brechungsindex | 1.615 |
Flammpunkt | 192.2°C |
Dampfdruck | 6.38E-07mmHg at 25°C |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |