Chemindex > 86-26-0
DE ▼
86-26-0 2-Methoxybiphenyl |
|
| Produkt-Name | 2-Methoxybiphenyl |
| Englischer Name | 2-Methoxybiphenyl;2-Phenylanisole;biphenyl-2-yl methyl ether;o-Methoxybiphenyl |
| Molekulare Formel | C13H12O |
| Molecular Weight | 184.2338 |
| InChl | InChI=1/C13H12O/c1-14-13-10-6-5-9-12(13)11-7-3-2-4-8-11/h2-10H,1H3 |
| CAS Registry Number | 86-26-0 |
| EINECS | 201-659-9 |
| Molecular Structure |  |
| Dichte | 1.03g/cm3 |
| Schmelzpunkt | 30-33℃ |
| Siedepunkt | 274°C at 760 mmHg |
| Brechungsindex | 1.556 |
| Flammpunkt | 101.3°C |
| Dampfdruck | 0.00928mmHg at 25°C |
| Gefahrensymbole |  Xn##Harmful:; |
| Risk Codes | R33##Danger of cummulative effects.:; |
| Safety Beschreibung | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |
- Wenn Sie vorhaben, Chemikalien aus China zu beziehen, gehen Sie einfach zum Einkaufszentrum ChemNet, wir erhalten für Sie den neuesten und wettbewerbsfähigen Preis von chinesischen Herstellern.Bitte besuchen Sie
ChemNet Mall
Der CAS-Datenbankdienst für Chemikalien wird von ChemIndex.com bereitgestellt 