ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
85-55-2 2-(4-Methylbenzoyl)benzoic acid |
|
Produkt-Name | 2-(4-Methylbenzoyl)benzoic acid |
Englischer Name | 2-(4-Methylbenzoyl)benzoic acid;2-(p-Toluoyl)benzoic acid;4-Methylbenzophenone-2-carboxylic acid;2-[(4-methylphenyl)carbonyl]benzoate |
Molekulare Formel | C15H11O3 |
Molecular Weight | 239.2466 |
InChl | InChI=1/C15H12O3/c1-10-6-8-11(9-7-10)14(16)12-4-2-3-5-13(12)15(17)18/h2-9H,1H3,(H,17,18)/p-1 |
CAS Registry Number | 85-55-2 |
EINECS | 201-614-3 |
Molecular Structure | |
Schmelzpunkt | 137-139℃ |
Siedepunkt | 457.1°C at 760 mmHg |
Flammpunkt | 244.3°C |
Dampfdruck | 3.79E-09mmHg at 25°C |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |