ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
84211-94-9 4-(Ethylthio)benzaldehyde |
|
Produkt-Name | 4-(Ethylthio)benzaldehyde |
Englischer Name | 4-(Ethylthio)benzaldehyde;4-(ethylsulfanyl)benzaldehyde |
Molekulare Formel | C9H10OS |
Molecular Weight | 166.2401 |
InChl | InChI=1/C9H10OS/c1-2-11-9-5-3-8(7-10)4-6-9/h3-7H,2H2,1H3 |
CAS Registry Number | 84211-94-9 |
Molecular Structure | |
Dichte | 1.1g/cm3 |
Siedepunkt | 281.6°C at 760 mmHg |
Brechungsindex | 1.565 |
Flammpunkt | 139.9°C |
Dampfdruck | 0.00353mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |