ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
4-Methoxy-1-naphthol |
|
Produkt-Name | 4-Methoxy-1-naphthol |
Englischer Name | 4-Methoxy-1-naphthol;1-Hydroxy-4-methoxynaphthalene;4-methoxynaphthalen-1-ol |
Molekulare Formel | C11H10O2 |
Molecular Weight | 174.1959 |
InChl | InChI=1/C11H10O2/c1-13-11-7-6-10(12)8-4-2-3-5-9(8)11/h2-7,12H,1H3 |
CAS Registry Number | 84-85-5 |
EINECS | 201-566-3 |
Molecular Structure | |
Dichte | 1.193g/cm3 |
Schmelzpunkt | 128-130℃ |
Siedepunkt | 350.1°C at 760 mmHg |
Brechungsindex | 1.64 |
Flammpunkt | 228.6°C |
Dampfdruck | 2.23E-05mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |