ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
84-60-6 2,6-Dihydroxyanthraquinone |
|
Produkt-Name | 2,6-Dihydroxyanthraquinone |
Englischer Name | 2,6-Dihydroxyanthraquinone; |
Molekulare Formel | C14H8O4 |
Molecular Weight | 240.2109 |
InChl | InChI=1/C14H8O4/c15-7-1-3-9-11(5-7)14(18)10-4-2-8(16)6-12(10)13(9)17/h1-6,15-16H |
CAS Registry Number | 84-60-6 |
EINECS | 201-544-3 |
Molecular Structure | |
Dichte | 1.54g/cm3 |
Schmelzpunkt | 320℃ |
Siedepunkt | 442.1°C at 760 mmHg |
Brechungsindex | 1.732 |
Flammpunkt | 235.3°C |
Dampfdruck | 1.99E-08mmHg at 25°C |
Gefahrensymbole | Xi##Irritant:; |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |