ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2,4,6-Trihydroxybenzoic acid |
|
Produkt-Name | 2,4,6-Trihydroxybenzoic acid |
Englischer Name | 2,4,6-Trihydroxybenzoic acid;Phloroglucinolcarboxylic acid;2,4,6-Trichydroxybenzoic acid;2,4,6-Trihydroxybenzene carboxylic acid;2,4,6-trihydroxy-benzoicaci;Benzoic acid, 2,4,6-trihydroxy-;Phloroglucincarboxylic acid;Phloroglucinic acid;phloroglucinicacid;RARECHEM AL BE 0039;2,4,6-trihydrobenzoic acid |
Molekulare Formel | C7H6O5 |
Molecular Weight | 170.1195 |
InChl | InChI=1/C7H6O5/c8-3-1-4(9)6(7(11)12)5(10)2-3/h1-2,8-10H,(H,11,12) |
CAS Registry Number | 83-30-7 |
EINECS | 201-467-5 |
Molecular Structure | |
Dichte | 1.749g/cm3 |
Schmelzpunkt | 210℃ |
Siedepunkt | 426.5°C at 760 mmHg |
Brechungsindex | 1.73 |
Flammpunkt | 225.9°C |
Dampfdruck | 4.93E-08mmHg at 25°C |
Gefahrensymbole | Xi:; |
Risk Codes | 36/37/38:; |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |