Chemindex > 825-52-5
DE ▼
825-52-5 2-hydroxyimino-2-phenylacetonitrile, mixture |
|
| Produkt-Name | 2-hydroxyimino-2-phenylacetonitrile, mixture |
| Englischer Name | 2-hydroxyimino-2-phenylacetonitrile, mixture;2-Hydroxyimino-2-phenylacetonitrile;Benzoyl cyanide oxime~Phenylglyoxylonitrile oxime;(hydroxyimino)(phenyl)acetonitrile;(2E)-(hydroxyimino)(phenyl)ethanenitrile |
| Molekulare Formel | C8H6N2O |
| Molecular Weight | 146.146 |
| InChl | InChI=1/C8H6N2O/c9-6-8(10-11)7-4-2-1-3-5-7/h1-5,11H/b10-8- |
| CAS Registry Number | 825-52-5 |
| EINECS | 212-546-9 |
| Molecular Structure |  |
| Dichte | 1.11g/cm3 |
| Schmelzpunkt | 128-130℃ |
| Siedepunkt | 293.3°C at 760 mmHg |
| Brechungsindex | 1.562 |
| Flammpunkt | 131.2°C |
| Dampfdruck | 0.000793mmHg at 25°C |
| Risk Codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| Safety Beschreibung | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |
- Wenn Sie vorhaben, Chemikalien aus China zu beziehen, gehen Sie einfach zum Einkaufszentrum ChemNet, wir erhalten für Sie den neuesten und wettbewerbsfähigen Preis von chinesischen Herstellern.Bitte besuchen Sie
ChemNet Mall
Der CAS-Datenbankdienst für Chemikalien wird von ChemIndex.com bereitgestellt 