ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Thianaphthene-1,1-dioxide |
|
Produkt-Name | Thianaphthene-1,1-dioxide |
Englischer Name | Thianaphthene-1,1-dioxide;Thianaphthene 1,1-dioxide;Benzo[b]thiophene 1,1-dioxide;1-benzothiophene 1,1-dioxide |
Molekulare Formel | C8H6O2S |
Molecular Weight | 166.197 |
InChl | InChI=1/C8H6O2S/c9-11(10)6-5-7-3-1-2-4-8(7)11/h1-6H |
CAS Registry Number | 825-44-5 |
EINECS | 212-544-8 |
Molecular Structure | |
Dichte | 1.403g/cm3 |
Schmelzpunkt | 137-138℃ |
Siedepunkt | 371.1°C at 760 mmHg |
Brechungsindex | 1.64 |
Flammpunkt | 244°C |
Dampfdruck | 2.25E-05mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |