ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
824-46-4 2-Methoxyhydroquinone |
|
Produkt-Name | 2-Methoxyhydroquinone |
Englischer Name | 2-Methoxyhydroquinone;2,5-Dihydroxyanisole;2-methoxyquinol;2-methoxybenzene-1,4-diol;Methoxy hydroquinone |
Molekulare Formel | C7H8O3 |
Molecular Weight | 140.1366 |
InChl | InChI=1/C7H8O3/c1-10-7-4-5(8)2-3-6(7)9/h2-4,8-9H,1H3 |
CAS Registry Number | 824-46-4 |
EINECS | 212-530-1 |
Molecular Structure | ![]() |
Dichte | 1.27g/cm3 |
Schmelzpunkt | 89-91℃ |
Siedepunkt | 311.3°C at 760 mmHg |
Brechungsindex | 1.579 |
Flammpunkt | 142.1°C |
Dampfdruck | 0.000311mmHg at 25°C |
Gefahrensymbole | |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S22||S24/25:; |
MSDS |