ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Cyclohexyl methyl ketone |
|
Produkt-Name | Cyclohexyl methyl ketone |
Englischer Name | Cyclohexyl methyl ketone;Acetylcyclohexane~Hexahydroacetophenone~Methyl cyclohexyl ketone;Acetylcyclohexane;1-cyclohexylethanone;1-CYCLOHEXYLETHAN-1-ONE |
Molekulare Formel | C8H14O |
Molecular Weight | 126.1962 |
InChl | InChI=1/C8H14O/c1-7(9)8-5-3-2-4-6-8/h8H,2-6H2,1H3 |
CAS Registry Number | 823-76-7 |
EINECS | 212-517-0 |
Molecular Structure | |
Dichte | 0.916g/cm3 |
Siedepunkt | 181.5°C at 760 mmHg |
Brechungsindex | 1.448 |
Flammpunkt | 61.4°C |
Dampfdruck | 0.849mmHg at 25°C |
Risk Codes | R36/38##Irritating to eyes and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |