ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
delta-Hexanolactone |
|
Produkt-Name | delta-Hexanolactone |
Englischer Name | delta-Hexanolactone;delta-Hexalactone;5-Hydroxyhexanoic acid lactone;6-methyltetrahydro-2H-pyran-2-one;(6S)-6-methyltetrahydro-2H-pyran-2-one |
Molekulare Formel | C6H10O2 |
Molecular Weight | 114.1424 |
InChl | InChI=1/C6H10O2/c1-5-3-2-4-6(7)8-5/h5H,2-4H2,1H3/t5-/m0/s1 |
CAS Registry Number | 823-22-3 |
EINECS | 212-511-8 |
Molecular Structure | |
Dichte | 1.001g/cm3 |
Siedepunkt | 215.7°C at 760 mmHg |
Brechungsindex | 1.43 |
Flammpunkt | 79.8°C |
Dampfdruck | 0.145mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |