ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
82-22-4 1,1'-Dianthrimid |
|
Produkt-Name | 1,1'-Dianthrimid |
Synonyme | ; 1,1-Iminodianthrachinon; 1,1'-Iminodianthracen-9,10-dion; |
Englischer Name | 1,1'-dianthrimide;1,1-iminodianthraquinone;1,1'-iminodianthracene-9,10-dione |
Molekulare Formel | C28H15NO4 |
Molecular Weight | 429.423 |
InChl | InChI=1/C28H15NO4/c30-25-15-7-1-3-9-17(15)27(32)23-19(25)11-5-13-21(23)29-22-14-6-12-20-24(22)28(33)18-10-4-2-8-16(18)26(20)31/h1-14,29H |
CAS Registry Number | 82-22-4 |
EINECS | 201-405-7 |
Molecular Structure | |
Dichte | 1.456g/cm3 |
Schmelzpunkt | 300℃ |
Siedepunkt | 667.1°C at 760 mmHg |
Brechungsindex | 1.753 |
Flammpunkt | 221.6°C |
Dampfdruck | 1.17E-17mmHg at 25°C |
Gefahrensymbole | Xi##Irritant:; |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |