ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
mono-methyl sebacate |
|
Produkt-Name | mono-methyl sebacate |
Englischer Name | mono-methyl sebacate;Monomethyl sebacate~Sebacic acid monomethyl ester;Sebacic acid monomethyl ester;Methyl hydrogen sebacate (Monomethyl sebacate; Sebacic acid monomethyl ester);monomethyl sebacate;10-methoxy-10-oxodecanoic acid |
Molekulare Formel | C11H20O4 |
Molecular Weight | 216.2741 |
InChl | InChI=1/C11H20O4/c1-15-11(14)9-7-5-3-2-4-6-8-10(12)13/h2-9H2,1H3,(H,12,13) |
CAS Registry Number | 818-88-2 |
EINECS | 212-458-0 |
Molecular Structure | |
Dichte | 1.038g/cm3 |
Schmelzpunkt | 41-44℃ |
Siedepunkt | 332.5°C at 760 mmHg |
Brechungsindex | 1.453 |
Flammpunkt | 115.4°C |
Dampfdruck | 2.8E-05mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |