ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
818-38-2 diethyl glutarate |
|
Produkt-Name | diethyl glutarate |
Englischer Name | diethyl glutarate;Diethyl glutarate, (Glutaric acid diethyl ester);Glutaric acid diethyl ester;Diethyl Pentanediate;diethyl pentanedioate |
Molekulare Formel | C9H16O4 |
Molecular Weight | 188.2209 |
InChl | InChI=1/C9H16O4/c1-3-12-8(10)6-5-7-9(11)13-4-2/h3-7H2,1-2H3 |
CAS Registry Number | 818-38-2 |
EINECS | 212-451-2 |
Molecular Structure | ![]() |
Dichte | 1.022g/cm3 |
Siedepunkt | 236.5°C at 760 mmHg |
Brechungsindex | 1.427 |
Flammpunkt | 96.1°C |
Dampfdruck | 0.0472mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |