ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
818-23-5 8-Pentadecanone |
|
Produkt-Name | 8-Pentadecanone |
Englischer Name | 8-Pentadecanone;Di-n-heptyl ketone;pentadecane-8-one;pentadecan-8-one |
Molekulare Formel | C15H30O |
Molecular Weight | 226.3981 |
InChl | InChI=1/C15H30O/c1-3-5-7-9-11-13-15(16)14-12-10-8-6-4-2/h3-14H2,1-2H3 |
CAS Registry Number | 818-23-5 |
EINECS | 212-450-7 |
Molecular Structure | |
Dichte | 0.828g/cm3 |
Schmelzpunkt | 40-44℃ |
Siedepunkt | 292.6°C at 760 mmHg |
Brechungsindex | 1.436 |
Flammpunkt | 83.1°C |
Dampfdruck | 0.00182mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |