ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
81593-28-4 2,5-Difluorphenylglyoxalhydrat |
|
Produkt-Name | 2,5-Difluorphenylglyoxalhydrat |
Synonyme | (2,5-Difluorphenyl) (Oxo)acetaldehydhydrat; |
Englischer Name | 2,5-Difluorophenylglyoxal hydrate;(2,5-difluorophenyl)(oxo)acetaldehyde hydrate |
Molekulare Formel | C8H6F2O3 |
Molecular Weight | 188.1282 |
InChl | InChI=1/C8H4F2O2.H2O/c9-5-1-2-7(10)6(3-5)8(12)4-11;/h1-4H;1H2 |
CAS Registry Number | 81593-28-4 |
Molecular Structure | |
Siedepunkt | 224.7°C at 760 mmHg |
Flammpunkt | 84.7°C |
Dampfdruck | 0.0899mmHg at 25°C |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |