ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
815-68-9 Triacetylmethane |
|
Produkt-Name | Triacetylmethane |
Englischer Name | Triacetylmethane;methine triacetate;3-acetylpentane-2,4-dione;3-(1-hydroxyethylidene)pentane-2,4-dione |
Molekulare Formel | C7H10O3 |
Molecular Weight | 142.1525 |
InChl | InChI=1/C7H10O3/c1-4(8)7(5(2)9)6(3)10/h8H,1-3H3 |
CAS Registry Number | 815-68-9 |
EINECS | 212-422-4 |
Molecular Structure | |
Dichte | 1.101g/cm3 |
Siedepunkt | 298.3°C at 760 mmHg |
Brechungsindex | 1.467 |
Flammpunkt | 148.4°C |
Dampfdruck | 0.000129mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |