ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
813-56-9 Malonsäure-d2-Säure-d2 |
|
Produkt-Name | Malonsäure-d2-Säure-d2 |
Synonyme | ; Malonsäure-d4; (~2~H_2_)Propan(~2~H_2_)Disäure; |
Englischer Name | Malonic-d2 acid-d2;Malonic acid-d4;(~2~H_2_)propane(~2~H_2_)dioic acid |
Molekulare Formel | C3D4O4 |
Molecular Weight | 108.0861 |
InChl | InChI=1/C3H4O4/c4-2(5)1-3(6)7/h1H2,(H,4,5)(H,6,7)/i1D2/hD2 |
CAS Registry Number | 813-56-9 |
EINECS | 212-385-4 |
Molecular Structure | ![]() |
Dichte | 1.605g/cm3 |
Schmelzpunkt | 130-132℃ |
Siedepunkt | 386.8°C at 760 mmHg |
Brechungsindex | 1.478 |
Flammpunkt | 201.9°C |
Dampfdruck | 4.66E-07mmHg at 25°C |
Gefahrensymbole | |
Risk Codes | R22##Harmful if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |