ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Hydroxynitroanthraquinone; 97% |
|
Produkt-Name | Hydroxynitroanthraquinone; 97% |
Englischer Name | Hydroxynitroanthraquinone; 97%;1-Hydroxy-4-nitroanthraquinone;1-Hydroxy-4-nitro-9,10-dihydroanthracene-9,10-dione;1-hydroxy-4-nitroanthracene-9,10-dione |
Molekulare Formel | C14H7NO5 |
Molecular Weight | 269.2091 |
InChl | InChI=1/C14H7NO5/c16-10-6-5-9(15(19)20)11-12(10)14(18)8-4-2-1-3-7(8)13(11)17/h1-6,16H |
CAS Registry Number | 81-65-2 |
Molecular Structure | |
Dichte | 1.589g/cm3 |
Schmelzpunkt | 273℃ |
Siedepunkt | 524.3°C at 760 mmHg |
Brechungsindex | 1.723 |
Flammpunkt | 225.9°C |
Dampfdruck | 1.31E-11mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |