Chemindex > 79-35-6
DE ▼
79-35-6 1,1-dichloro-2,2-difluoroethylene |
|
| Produkt-Name | 1,1-dichloro-2,2-difluoroethylene |
| Englischer Name | 1,1-dichloro-2,2-difluoroethylene;FC-1112a;1-chloro-1,2,2-trifluoroethene |
| Molekulare Formel | C2Cl2F2 |
| Molecular Weight | 132.9242 |
| InChl | InChI=1/C2Cl2F2/c3-1(4)2(5)6 |
| CAS Registry Number | 79-35-6 |
| EINECS | 201-198-3 |
| Molecular Structure |  |
| Dichte | 1.503g/cm3 |
| Siedepunkt | 17.3°C at 760 mmHg |
| Brechungsindex | 1.392 |
| Dampfdruck | 999mmHg at 25°C |
| Risk Codes | R23##Toxic by inhalation.||R36/38##Irritating to eyes and skin.:; |
| Safety Beschreibung | S23##Do not inhale gas/fumes/vapour/spray.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S9##Keep container in a well-ventilated place.:; |
| MSDS | |
- Wenn Sie vorhaben, Chemikalien aus China zu beziehen, gehen Sie einfach zum Einkaufszentrum ChemNet, wir erhalten für Sie den neuesten und wettbewerbsfähigen Preis von chinesischen Herstellern.Bitte besuchen Sie
ChemNet Mall
Der CAS-Datenbankdienst für Chemikalien wird von ChemIndex.com bereitgestellt 