ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
77-73-6 Dicyclopentadiene |
|
Produkt-Name | Dicyclopentadiene |
Englischer Name | Dicyclopentadiene;3a,4,7,7a-Tetrahydro-4,7-methanoindene;Cyclopentadiene dimer~3a,4,7,7a-Tetrahydro-4,7-methanoindene;DCPD;dicyclopentadiene (stabilized with bht);Dicyclopentadiene (>95%);Dicyclopentadiene (70%);Dicyopentadiene;Dicyclopentadiene (80%);Dicyclopentadiene dimer |
Molekulare Formel | C10H12 |
Molecular Weight | 132.2 |
InChl | InChI=1/C10H12/c1-2-9-7-4-5-8(6-7)10(9)3-1/h1-2,4-5,7-10H,3,6H2 |
CAS Registry Number | 77-73-6 |
EINECS | 201-052-9 |
Molecular Structure | |
Dichte | 0.982 |
Schmelzpunkt | -1℃ |
Siedepunkt | 170℃ |
Brechungsindex | 1.51-1.512 |
Flammpunkt | 26℃ |
Gefahrensymbole | F##Flammable||Xn##Harmful||N##Dangerous for the environment:; |
Risk Codes | R11||R20/22||R36/37/38||R51/53:; |
Safety Beschreibung | S36/37||S61:; |
MSDS |