ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
77-61-2 2,4-Dimethyl-6-(1-methylcyclohexyl)phenol |
|
Produkt-Name | 2,4-Dimethyl-6-(1-methylcyclohexyl)phenol |
Synonyme | Lowinox(rg WSL; 6-(1-Methylcyclohexyl)-2,4-xylenol; |
Englischer Name | 2,4-Dimethyl-6-(1-methylcyclohexyl)phenol;Lowinox(rg WSL;6-(1-Methylcyclohexyl)-2,4-xylenol |
Molekulare Formel | C15H22O |
Molecular Weight | 218.3346 |
InChl | InChI=1/C15H22O/c1-11-9-12(2)14(16)13(10-11)15(3)7-5-4-6-8-15/h9-10,16H,4-8H2,1-3H3 |
CAS Registry Number | 77-61-2 |
EINECS | 201-042-4 |
Molecular Structure | |
Dichte | 0.992g/cm3 |
Siedepunkt | 311°C at 760 mmHg |
Brechungsindex | 1.532 |
Flammpunkt | 140°C |
Dampfdruck | 0.000317mmHg at 25°C |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.||R43##May cause sensitization by skin contact.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |