ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
76649-14-4 3-Octen-2-ol |
|
Produkt-Name | 3-Octen-2-ol |
Englischer Name | 3-Octen-2-ol;FEMA No. 3602;oct-3-en-2-ol;(3E)-oct-3-en-2-ol |
Molekulare Formel | C8H16O |
Molecular Weight | 128.212 |
InChl | InChI=1/C8H16O/c1-3-4-5-6-7-8(2)9/h6-9H,3-5H2,1-2H3/b7-6+ |
CAS Registry Number | 76649-14-4 |
EINECS | 278-508-9 |
Molecular Structure | ![]() |
Dichte | 0.843g/cm3 |
Siedepunkt | 178.8°C at 760 mmHg |
Brechungsindex | 1.447 |
Flammpunkt | 63.4°C |
Dampfdruck | 0.291mmHg at 25°C |
Risk Codes | R36/38##Irritating to eyes and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |