ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Bromodichloromethane |
|
Produkt-Name | Bromodichloromethane |
Englischer Name | Bromodichloromethane;FC-20B1 |
Molekulare Formel | CHBrCl2 |
Molecular Weight | 163.8286 |
InChl | InChI=1/CHBrCl2/c2-1(3)4/h1H |
CAS Registry Number | 75-27-4 |
EINECS | 200-856-7 |
Molecular Structure | |
Dichte | 2.013g/cm3 |
Schmelzpunkt | -55℃ |
Siedepunkt | 89.7°C at 760 mmHg |
Brechungsindex | 1.503 |
Flammpunkt | 1.3°C |
Dampfdruck | 65.3mmHg at 25°C |
Gefahrensymbole | Xn##Harmful:; |
Risk Codes | R22##Harmful if swallowed.||R40##Possible risks of irreversible effects.:; |
Safety Beschreibung | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |