ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
728-87-0 4,4'-Dimethoxybenzhydrol |
|
Produkt-Name | 4,4'-Dimethoxybenzhydrol |
Englischer Name | 4,4'-Dimethoxybenzhydrol;Bis(4-methoxyphenyl) carbinol;4,4-Dimethoxydiphenylmethanol;4,4-Dimethoxybenzhydrol;Bis(4-methoxyphenyl)carbinol;bis(4-methoxyphenyl)methanol |
Molekulare Formel | C15H16O3 |
Molecular Weight | 244.2857 |
InChl | InChI=1/C15H16O3/c1-17-13-7-3-11(4-8-13)15(16)12-5-9-14(18-2)10-6-12/h3-10,15-16H,1-2H3 |
CAS Registry Number | 728-87-0 |
EINECS | 211-975-9 |
Molecular Structure | |
Dichte | 1.135g/cm3 |
Schmelzpunkt | 68-72℃ |
Siedepunkt | 406.5°C at 760 mmHg |
Brechungsindex | 1.568 |
Flammpunkt | 199.6°C |
Dampfdruck | 2.46E-07mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |