ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
720-44-5 4-Methoxybenzhydrol |
|
Produkt-Name | 4-Methoxybenzhydrol |
Englischer Name | 4-Methoxybenzhydrol;4-Methoxydiphenylmethanol~4-Methoxyphenyl phenyl carbinol;(4-methoxyphenyl)(phenyl)methanol |
Molekulare Formel | C14H14O2 |
Molecular Weight | 214.2598 |
InChl | InChI=1/C14H14O2/c1-16-13-9-7-12(8-10-13)14(15)11-5-3-2-4-6-11/h2-10,14-15H,1H3 |
CAS Registry Number | 720-44-5 |
EINECS | 211-953-9 |
Molecular Structure | ![]() |
Dichte | 1.121g/cm3 |
Siedepunkt | 363.2°C at 760 mmHg |
Brechungsindex | 1.582 |
Flammpunkt | 164.5°C |
Dampfdruck | 6.55E-06mmHg at 25°C |
Safety Beschreibung | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |