ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
72-55-9 2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene |
|
Produkt-Name | 2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene |
Englischer Name | 2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene;p,p-DDE |
Molekulare Formel | C14H8Cl4 |
Molecular Weight | 318.02 |
InChl | InChI=1/C14H8Cl4/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8H |
CAS Registry Number | 72-55-9 |
EINECS | 200-784-6 |
Molecular Structure | ![]() |
Schmelzpunkt | 87-90℃ |
Wasserlöslichkeit | 0.00000013 g/100 mL |
Gefahrensymbole | |
Risk Codes | R22##Harmful if swallowed.||R33##Danger of cummulative effects.:; |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |