ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
717-27-1 Methylhydroquinone diacetate |
|
Produkt-Name | Methylhydroquinone diacetate |
Englischer Name | Methylhydroquinone diacetate;2,5-Diacetoxytoluene;2-methylbenzene-1,4-diyl diacetate |
Molekulare Formel | C11H12O4 |
Molecular Weight | 208.2106 |
InChl | InChI=1/C11H12O4/c1-7-6-10(14-8(2)12)4-5-11(7)15-9(3)13/h4-6H,1-3H3 |
CAS Registry Number | 717-27-1 |
Molecular Structure | ![]() |
Dichte | 1.15g/cm3 |
Siedepunkt | 289.7°C at 760 mmHg |
Brechungsindex | 1.505 |
Flammpunkt | 140.2°C |
Dampfdruck | 0.00217mmHg at 25°C |
Safety Beschreibung | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |