ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
6-Nitropiperonal |
|
Produkt-Name | 6-Nitropiperonal |
Englischer Name | 6-Nitropiperonal;(3,4-Methylenedioxy-6-nitrobenzald;4,5-Methylenedioxy-2-nitrobenzaldehyde;6-Nitro-1,3-benzodioxole-5-carboxaldehyde;6-nitro-1,3-benzodioxole-5-carbaldehyde;4,5-(Methylenedioxy)-2-nitrobenzaldehyde |
Molekulare Formel | C8H5NO5 |
Molecular Weight | 195.129 |
InChl | InChI=1/C8H5NO5/c10-3-5-1-7-8(14-4-13-7)2-6(5)9(11)12/h1-3H,4H2 |
CAS Registry Number | 712-97-0 |
EINECS | 211-926-1 |
Molecular Structure | |
Dichte | 1.572g/cm3 |
Schmelzpunkt | 93-96℃ |
Siedepunkt | 365.9°C at 760 mmHg |
Brechungsindex | 1.658 |
Flammpunkt | 195°C |
Dampfdruck | 1.52E-05mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |