ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Bis(2-thienyl) ketone |
|
Produkt-Name | Bis(2-thienyl) ketone |
Englischer Name | Bis(2-thienyl) ketone;Di-2-thienyl ketone;Bis(2-thienyl)ketone~Di-2-thienyl ketone;dithiophen-2-ylmethanone |
Molekulare Formel | C9H6OS2 |
Molecular Weight | 194.2733 |
InChl | InChI=1/C9H6OS2/c10-9(7-3-1-5-11-7)8-4-2-6-12-8/h1-6H |
CAS Registry Number | 704-38-1 |
Molecular Structure | |
Dichte | 1.326g/cm3 |
Schmelzpunkt | 89-91℃ |
Siedepunkt | 323°C at 760 mmHg |
Brechungsindex | 1.64 |
Flammpunkt | 149.1°C |
Dampfdruck | 0.00027mmHg at 25°C |
Safety Beschreibung | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |