ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Homophthalic anhydride |
|
Produkt-Name | Homophthalic anhydride |
Englischer Name | Homophthalic anhydride;1,3-Isochromandione;benzoglutaric anhydride;1H-isochromene-1,3(4H)-dione;o-Carboxyphenylacetic acid cyclic anhydride~1,3-Isochromanedione |
Molekulare Formel | C9H6O3 |
Molecular Weight | 162.1421 |
InChl | InChI=1/C9H6O3/c10-8-5-6-3-1-2-4-7(6)9(11)12-8/h1-4H,5H2 |
CAS Registry Number | 703-59-3 |
EINECS | 211-873-4 |
Molecular Structure | |
Dichte | 1.347g/cm3 |
Schmelzpunkt | 140-144℃ |
Siedepunkt | 324.5°C at 760 mmHg |
Brechungsindex | 1.584 |
Flammpunkt | 159°C |
Dampfdruck | 0.000244mmHg at 25°C |
Gefahrensymbole | Xi##Irritant:; |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |