ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
703-56-0 3-Phenyl-2-oxazolidinone |
|
Produkt-Name | 3-Phenyl-2-oxazolidinone |
Englischer Name | 3-Phenyl-2-oxazolidinone;NSC 37752;3-phenyl-1,3-oxazolidin-2-one |
Molekulare Formel | C9H9NO2 |
Molecular Weight | 163.1733 |
InChl | InChI=1/C9H9NO2/c11-9-10(6-7-12-9)8-4-2-1-3-5-8/h1-5H,6-7H2 |
CAS Registry Number | 703-56-0 |
Molecular Structure | |
Dichte | 1.24g/cm3 |
Siedepunkt | 251.6°C at 760 mmHg |
Brechungsindex | 1.577 |
Flammpunkt | 106°C |
Dampfdruck | 0.0203mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |