ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
4-Methoxyphenethyl alcohol |
|
Produkt-Name | 4-Methoxyphenethyl alcohol |
Englischer Name | 4-Methoxyphenethyl alcohol;p-Methoxyphenethyl alcohol;2-(4-Methoxyphenyl)ethanol;p-Methoxyphenylethanol |
Molekulare Formel | C9H12O2 |
Molecular Weight | 152.1904 |
InChl | InChI=1/C9H12O2/c1-11-9-4-2-8(3-5-9)6-7-10/h2-5,10H,6-7H2,1H3 |
CAS Registry Number | 702-23-8 |
EINECS | 211-866-6 |
Molecular Structure | |
Dichte | 1.058g/cm3 |
Schmelzpunkt | 28℃ |
Siedepunkt | 257.5°C at 760 mmHg |
Brechungsindex | 1.524 |
Flammpunkt | 110.2°C |
Dampfdruck | 0.00745mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |