ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Alpha-Ethylphenethyl alcohol |
|
Produkt-Name | Alpha-Ethylphenethyl alcohol |
Englischer Name | Alpha-Ethylphenethyl alcohol;1-Phenyl-2-butanol;1-phenylbutan-2-ol;(2S)-1-phenylbutan-2-ol;(2R)-1-phenylbutan-2-ol |
Molekulare Formel | C10H14O |
Molecular Weight | 150.2176 |
InChl | InChI=1/C10H14O/c1-2-10(11)8-9-6-4-3-5-7-9/h3-7,10-11H,2,8H2,1H3/t10-/m1/s1 |
CAS Registry Number | 701-70-2 |
EINECS | 211-858-2 |
Molecular Structure | |
Dichte | 0.98g/cm3 |
Siedepunkt | 226.6°C at 760 mmHg |
Brechungsindex | 1.52 |
Flammpunkt | 100°C |
Dampfdruck | 0.0459mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |