ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
70-57-5 5-Methylnicotinamide |
|
Produkt-Name | 5-Methylnicotinamide |
Englischer Name | 5-Methylnicotinamide;5-Methylpyridine-3-carboxamide |
Molekulare Formel | C7H8N2O |
Molecular Weight | 136.1512 |
InChl | InChI=1/C7H8N2O/c1-5-2-6(7(8)10)4-9-3-5/h2-4H,1H3,(H2,8,10) |
CAS Registry Number | 70-57-5 |
Molecular Structure | ![]() |
Dichte | 1.157g/cm3 |
Siedepunkt | 290°C at 760 mmHg |
Brechungsindex | 1.561 |
Flammpunkt | 129.2°C |
Dampfdruck | 0.00213mmHg at 25°C |
Safety Beschreibung | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |