ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
65445-74-1 1,2-Dihydropyridazin-3,6-dion, Verbindung mit Dimethylamin (1:1) |
|
Produkt-Name | 1,2-Dihydropyridazin-3,6-dion, Verbindung mit Dimethylamin (1:1) |
Synonyme | 1,2-Dihydropyridazin-3,6-dion, Verbindung mit Dimethylamin (1:1); 1,2-Dihydropyridazin-3,6-dion-N-methylmethanamin (1:1); |
Englischer Name | 1,2-dihydropyridazine-3,6-dione, compound with dimethylamine (1:1);1,2-Dihydropyridazine-3,6-dione, compound with dimethylamine (1:1);1,2-dihydropyridazine-3,6-dione - N-methylmethanamine (1:1) |
Molekulare Formel | C6H11N3O2 |
Molecular Weight | 157.1704 |
InChl | InChI=1/C4H4N2O2.C2H7N/c7-3-1-2-4(8)6-5-3;1-3-2/h1-2H,(H,5,7)(H,6,8);3H,1-2H3 |
CAS Registry Number | 65445-74-1 |
EINECS | 265-780-9 |
Molecular Structure | |
Siedepunkt | 251.7°C at 760 mmHg |
Flammpunkt | 108.9°C |
Dampfdruck | 0.0202mmHg at 25°C |
MSDS |