ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
64399-27-5 1-(4-Chlorophenyl)-1-cyclopropanecarbonitrile |
|
Produkt-Name | 1-(4-Chlorophenyl)-1-cyclopropanecarbonitrile |
Englischer Name | 1-(4-Chlorophenyl)-1-cyclopropanecarbonitrile;1-(p-Chlorophenyl)cyclopropanecarbonitrile;1-(4-chlorophenyl)cyclopropanecarbonitrile |
Molekulare Formel | C10H8ClN |
Molecular Weight | 177.6302 |
InChl | InChI=1/C10H8ClN/c11-9-3-1-8(2-4-9)10(7-12)5-6-10/h1-4H,5-6H2 |
CAS Registry Number | 64399-27-5 |
EINECS | 264-871-0 |
Molecular Structure | |
Dichte | 1.24g/cm3 |
Schmelzpunkt | 52-56℃ |
Siedepunkt | 303.1°C at 760 mmHg |
Brechungsindex | 1.589 |
Flammpunkt | 133.1°C |
Dampfdruck | 0.000947mmHg at 25°C |
Gefahrensymbole | Xi##Irritant:; |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |